C16H22F3N5O5S — CID 67580801
(2R,5R)-2-(hydroxymethyl)-5-[6-(2-methoxyethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol (PubChem CID 67580801) has the molecular formula C16H22F3N5O5S and a molecular weight of 453.44 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-5-[6-(2-methoxyethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-5-[6-(2-methoxyethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67580801 |
| Molecular Formula | C16H22F3N5O5S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-5-[6-(2-methoxyethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol |
| SMILES | COCCNc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](CO)C(O)C1O |
| InChI | InChI=1S/C16H22F3N5O5S/c1-28-4-3-20-12-9-13(23-15(22-12)30-5-2-16(17,18)19)24(7-21-9)14-11(27)10(26)8(6-25)29-14/h7-8,10-11,14,25-27H,2-6H2,1H3,(H,20,22,23)/t8-,10?,11?,14-/m1/s1 |
| InChIKey | CQDYALLAOQSJIY-BUTJNPDOSA-N |
| XLogP | 0.54 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|