C16H21Cl2F3N5O5PS2 — CID 157167498
(2R,4S,5R)-2-(dichlorophosphoryloxymethyl)-5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol (PubChem CID 157167498) has the molecular formula C16H21Cl2F3N5O5PS2 and a molecular weight of 586.38 g/mol. Its IUPAC name is (2R,4S,5R)-2-(dichlorophosphoryloxymethyl)-5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,4S,5R)-2-(dichlorophosphoryloxymethyl)-5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 157167498 |
| Molecular Formula | C16H21Cl2F3N5O5PS2 |
| Molecular Weight | 586.38 g/mol |
| Exact Mass | 585.01 |
| IUPAC Name | (2R,4S,5R)-2-(dichlorophosphoryloxymethyl)-5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolane-3,4-diol |
| SMILES | CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(Cl)Cl)C(O)[C@@H]1O |
| InChI | InChI=1S/C16H21Cl2F3N5O5PS2/c1-33-5-3-22-12-9-13(25-15(24-12)34-4-2-16(19,20)21)26(7-23-9)14-11(28)10(27)8(31-14)6-30-32(17,18)29/h7-8,10-11,14,27-28H,2-6H2,1H3,(H,22,24,25)/t8-,10?,11+,14-/m1/s1 |
| InChIKey | ANBUSMIUVXBEPC-PODXTCKDSA-N |
| XLogP | 3.87 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|