C34H28N4O9 — CID 134914534
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6,7-dimethyl-2,4-dioxopteridin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 134914534) has the molecular formula C34H28N4O9 and a molecular weight of 636.62 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6,7-dimethyl-2,4-dioxopteridin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6,7-dimethyl-2,4-dioxopteridin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134914534 |
| Molecular Formula | C34H28N4O9 |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6,7-dimethyl-2,4-dioxopteridin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cc1nc2c(=O)[nH]c(=O)n([C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)c2nc1C |
| InChI | InChI=1S/C34H28N4O9/c1-19-20(2)36-28-25(35-19)29(39)37-34(43)38(28)30-27(47-33(42)23-16-10-5-11-17-23)26(46-32(41)22-14-8-4-9-15-22)24(45-30)18-44-31(40)21-12-6-3-7-13-21/h3-17,24,26-27,30H,18H2,1-2H3,(H,37,39,43)/t24-,26-,27-,30-/m1/s1 |
| InChIKey | IVOQVVUYRTUYFS-BQOYKFDPSA-N |
| XLogP | 3.30 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|