C33H30N4O11 — CID 99688936
[(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-[6-[(2-ethoxy-2-oxoethyl)amino]-3,5-dioxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate (PubChem CID 99688936) has the molecular formula C33H30N4O11 and a molecular weight of 658.62 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-[6-[(2-ethoxy-2-oxoethyl)amino]-3,5-dioxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-[6-[(2-ethoxy-2-oxoethyl)amino]-3,5-dioxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 99688936 |
| Molecular Formula | C33H30N4O11 |
| Molecular Weight | 658.62 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | [(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-[6-[(2-ethoxy-2-oxoethyl)amino]-3,5-dioxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CCOC(=O)CNc1nn([C@H]2O[C@@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]2OC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H30N4O11/c1-2-44-24(38)18-34-27-28(39)35-33(43)37(36-27)29-26(48-32(42)22-16-10-5-11-17-22)25(47-31(41)21-14-8-4-9-15-21)23(46-29)19-45-30(40)20-12-6-3-7-13-20/h3-17,23,25-26,29H,2,18-19H2,1H3,(H,34,36)(H,35,39,43)/t23-,25+,26-,29-/m0/s1 |
| InChIKey | YIBGABDTNWKKJI-NRCOOORZSA-N |
| XLogP | 2.11 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|