C36H29N3O8S2 — CID 99657387
[(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-(6-benzylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate (PubChem CID 99657387) has the molecular formula C36H29N3O8S2 and a molecular weight of 695.78 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-(6-benzylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-(6-benzylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 99657387 |
| Molecular Formula | C36H29N3O8S2 |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.14 |
| IUPAC Name | [(2S,3R,4S,5S)-3,4-dibenzoyloxy-5-(6-benzylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1O[C@H](n2nc(SCc3ccccc3)c(=S)[nH]c2=O)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H29N3O8S2/c40-33(24-15-7-2-8-16-24)44-21-27-28(46-34(41)25-17-9-3-10-18-25)29(47-35(42)26-19-11-4-12-20-26)32(45-27)39-36(43)37-30(48)31(38-39)49-22-23-13-5-1-6-14-23/h1-20,27-29,32H,21-22H2,(H,37,43,48)/t27-,28+,29-,32-/m0/s1 |
| InChIKey | CJAVQGNQEZZJRN-ZRDZJBIISA-N |
| XLogP | 5.80 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|