C30H25N3O8S2 — CID 3301911
[3,4-dibenzoyloxy-5-(6-methylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate (PubChem CID 3301911) has the molecular formula C30H25N3O8S2 and a molecular weight of 619.68 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-(6-methylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-(6-methylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 3301911 |
| Molecular Formula | C30H25N3O8S2 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.11 |
| IUPAC Name | [3,4-dibenzoyloxy-5-(6-methylsulfanyl-3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl benzoate |
| SMILES | CSc1nn(C2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C30H25N3O8S2/c1-43-25-24(42)31-30(37)33(32-25)26-23(41-29(36)20-15-9-4-10-16-20)22(40-28(35)19-13-7-3-8-14-19)21(39-26)17-38-27(34)18-11-5-2-6-12-18/h2-16,21-23,26H,17H2,1H3,(H,31,37,42) |
| InChIKey | SYAMVUMWPINMJM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|