C26H24O6S — CID 131877463
[(2R,3S,4S,5R)-3-benzoyloxy-5-benzylsulfanyl-4-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 131877463) has the molecular formula C26H24O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3-benzoyloxy-5-benzylsulfanyl-4-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R)-3-benzoyloxy-5-benzylsulfanyl-4-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 131877463 |
| Molecular Formula | C26H24O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(2R,3S,4S,5R)-3-benzoyloxy-5-benzylsulfanyl-4-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](SCc2ccccc2)[C@@H](O)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24O6S/c27-22-23(32-25(29)20-14-8-3-9-15-20)21(16-30-24(28)19-12-6-2-7-13-19)31-26(22)33-17-18-10-4-1-5-11-18/h1-15,21-23,26-27H,16-17H2/t21-,22+,23-,26-/m1/s1 |
| InChIKey | YVBHTHHABQEDPF-ZGXDEKTJSA-N |
| XLogP | 4.09 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |