C35H33N5O11 — CID 4622625
[3,4-dibenzoyloxy-5-[5-[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]amino]-3-oxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate (PubChem CID 4622625) has the molecular formula C35H33N5O11 and a molecular weight of 699.67 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-[5-[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]amino]-3-oxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-[5-[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]amino]-3-oxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 4622625 |
| Molecular Formula | C35H33N5O11 |
| Molecular Weight | 699.67 g/mol |
| Exact Mass | 699.22 |
| IUPAC Name | [3,4-dibenzoyloxy-5-[5-[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]amino]-3-oxo-1,2,4-triazin-2-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CCOC(=O)CNC(=O)CNc1cnn(C2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C35H33N5O11/c1-2-47-28(42)20-37-27(41)19-36-26-18-38-40(35(46)39-26)31-30(51-34(45)24-16-10-5-11-17-24)29(50-33(44)23-14-8-4-9-15-23)25(49-31)21-48-32(43)22-12-6-3-7-13-22/h3-18,25,29-31H,2,19-21H2,1H3,(H,37,41)(H,36,39,46) |
| InChIKey | TVXRMAJRMBCBKD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 203.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.67 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|