C31H25N5O7 — CID 149001701
[(2R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 149001701) has the molecular formula C31H25N5O7 and a molecular weight of 579.57 g/mol. Its IUPAC name is [(2R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 149001701 |
| Molecular Formula | C31H25N5O7 |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | [(2R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | Nc1ncnc2c1cnn2[C@@H]1O[C@H](COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H25N5O7/c32-26-22-16-35-36(27(22)34-18-33-26)28-25(43-31(39)21-14-8-3-9-15-21)24(42-30(38)20-12-6-2-7-13-20)23(41-28)17-40-29(37)19-10-4-1-5-11-19/h1-16,18,23-25,28H,17H2,(H2,32,33,34)/t23-,24?,25?,28-/m1/s1 |
| InChIKey | PZTZAANVHDPDMS-SCZYLOFFSA-N |
| XLogP | 3.61 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|