C37H32N2O10 — CID 10394640
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[4-(6-methoxy-6-oxohex-1-ynyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate (PubChem CID 10394640) has the molecular formula C37H32N2O10 and a molecular weight of 664.67 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[4-(6-methoxy-6-oxohex-1-ynyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[4-(6-methoxy-6-oxohex-1-ynyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10394640 |
| Molecular Formula | C37H32N2O10 |
| Molecular Weight | 664.67 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[4-(6-methoxy-6-oxohex-1-ynyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
| SMILES | COC(=O)CCCC#Cc1ccn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C37H32N2O10/c1-45-30(40)21-13-5-12-20-28-22-23-39(37(44)38-28)33-32(49-36(43)27-18-10-4-11-19-27)31(48-35(42)26-16-8-3-9-17-26)29(47-33)24-46-34(41)25-14-6-2-7-15-25/h2-4,6-11,14-19,22-23,29,31-33H,5,13,21,24H2,1H3/t29-,31-,32-,33-/m1/s1 |
| InChIKey | VNFODECCHVPRSX-WXQJYUTRSA-N |
| XLogP | 4.14 |
| TPSA | 149.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|