C30H30N2O7 — CID 22856730
[(2R,3R,4R,5R)-3-benzoyloxy-5-(4-hex-1-ynyl-2-oxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]methyl benzoate (PubChem CID 22856730) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-benzoyloxy-5-(4-hex-1-ynyl-2-oxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3-benzoyloxy-5-(4-hex-1-ynyl-2-oxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 22856730 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3-benzoyloxy-5-(4-hex-1-ynyl-2-oxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]methyl benzoate |
| SMILES | CCCCC#Cc1ccn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC)c(=O)n1 |
| InChI | InChI=1S/C30H30N2O7/c1-3-4-5-12-17-23-18-19-32(30(35)31-23)27-26(36-2)25(39-29(34)22-15-10-7-11-16-22)24(38-27)20-37-28(33)21-13-8-6-9-14-21/h6-11,13-16,18-19,24-27H,3-5,20H2,1-2H3/t24-,25-,26-,27-/m1/s1 |
| InChIKey | DMDGLNUPFZHGHA-FPCALVHFSA-N |
| XLogP | 3.78 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|