C27H26N2O8 — CID 135462497
[(2R,3R,4R,5R)-3-benzoyloxy-5-[2-[(Z)-2-hydroxyprop-1-enyl]-4-oxopyrimidin-1-yl]-4-methoxyoxolan-2-yl]methyl benzoate (PubChem CID 135462497) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-benzoyloxy-5-[2-[(Z)-2-hydroxyprop-1-enyl]-4-oxopyrimidin-1-yl]-4-methoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3-benzoyloxy-5-[2-[(Z)-2-hydroxyprop-1-enyl]-4-oxopyrimidin-1-yl]-4-methoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 135462497 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3-benzoyloxy-5-[2-[(Z)-2-hydroxyprop-1-enyl]-4-oxopyrimidin-1-yl]-4-methoxyoxolan-2-yl]methyl benzoate |
| SMILES | CO[C@@H]1[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1ccc(=O)nc1/C=C(/C)O |
| InChI | InChI=1S/C27H26N2O8/c1-17(30)15-21-28-22(31)13-14-29(21)25-24(34-2)23(37-27(33)19-11-7-4-8-12-19)20(36-25)16-35-26(32)18-9-5-3-6-10-18/h3-15,20,23-25,30H,16H2,1-2H3/b17-15-/t20-,23-,24-,25-/m1/s1 |
| InChIKey | OCMGIOSLCOJJRE-DBGYELTGSA-N |
| XLogP | 3.16 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|