C38H29N5O8 — CID 102002475
[(2R,3R,4R,5R)-5-(4-amino-7-oxo-2-phenylpteridin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 102002475) has the molecular formula C38H29N5O8 and a molecular weight of 683.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-7-oxo-2-phenylpteridin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-7-oxo-2-phenylpteridin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102002475 |
| Molecular Formula | C38H29N5O8 |
| Molecular Weight | 683.68 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-7-oxo-2-phenylpteridin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | Nc1nc(-c2ccccc2)nc2c1ncc(=O)n2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H29N5O8/c39-32-29-34(42-33(41-32)23-13-5-1-6-14-23)43(28(44)21-40-29)35-31(51-38(47)26-19-11-4-12-20-26)30(50-37(46)25-17-9-3-10-18-25)27(49-35)22-48-36(45)24-15-7-2-8-16-24/h1-21,27,30-31,35H,22H2,(H2,39,41,42)/t27-,30-,31-,35-/m1/s1 |
| InChIKey | YOBUUKKGMAPBJI-PLXIXOFTSA-N |
| XLogP | 4.64 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|