C38H29N5O9 — CID 101218828
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-methyl-5,7-dioxo-3-phenylpyrimido[5,4-e][1,2,4]triazin-8-yl)oxolan-2-yl]methyl benzoate (PubChem CID 101218828) has the molecular formula C38H29N5O9 and a molecular weight of 699.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-methyl-5,7-dioxo-3-phenylpyrimido[5,4-e][1,2,4]triazin-8-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-methyl-5,7-dioxo-3-phenylpyrimido[5,4-e][1,2,4]triazin-8-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101218828 |
| Molecular Formula | C38H29N5O9 |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 699.20 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-methyl-5,7-dioxo-3-phenylpyrimido[5,4-e][1,2,4]triazin-8-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cn1c(=O)c2nc(-c3ccccc3)nnc2n([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C38H29N5O9/c1-42-33(44)28-32(41-40-31(39-28)23-14-6-2-7-15-23)43(38(42)48)34-30(52-37(47)26-20-12-5-13-21-26)29(51-36(46)25-18-10-4-11-19-25)27(50-34)22-49-35(45)24-16-8-3-9-17-24/h2-21,27,29-30,34H,22H2,1H3/t27-,29-,30-,34-/m1/s1 |
| InChIKey | RDIQSIYAACYINJ-WIFIACMTSA-N |
| XLogP | 3.76 |
| TPSA | 170.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|