C23H25N7O7 — CID 158093803
[(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-methoxyphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate (PubChem CID 158093803) has the molecular formula C23H25N7O7 and a molecular weight of 511.50 g/mol. Its IUPAC name is [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-methoxyphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-methoxyphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 158093803 |
| Molecular Formula | C23H25N7O7 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-methoxyphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
| SMILES | C=Nc1nc2c(nc(/N=N/c3ccc(OC)cc3)n2[C@@H]2O[C@H](CC)[C@H](OC(C)=O)C2OC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C23H25N7O7/c1-6-15-17(35-11(2)31)18(36-12(3)32)21(37-15)30-19-16(20(33)27-22(24-4)26-19)25-23(30)29-28-13-7-9-14(34-5)10-8-13/h7-10,15,17-18,21H,4,6H2,1-3,5H3,(H,26,27,33)/b29-28+/t15-,17+,18?,21-/m1/s1 |
| InChIKey | GXGLYCYAEIINBG-NOXCMJHESA-N |
| XLogP | 3.05 |
| TPSA | 171.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|