C38H40N6O8S — CID 135516584
[(2R,3S,4R,5R)-4-acetylsulfanyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate (PubChem CID 135516584) has the molecular formula C38H40N6O8S and a molecular weight of 740.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetylsulfanyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetylsulfanyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 135516584 |
| Molecular Formula | C38H40N6O8S |
| Molecular Weight | 740.84 g/mol |
| Exact Mass | 740.26 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetylsulfanyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(/N=C/N(C)C)nc43)[C@H](OC(C)=O)[C@@H]2SC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H40N6O8S/c1-23(45)51-32-33(53-24(2)46)30(52-36(32)44-22-39-31-34(44)41-37(42-35(31)47)40-21-43(3)4)20-50-38(25-10-8-7-9-11-25,26-12-16-28(48-5)17-13-26)27-14-18-29(49-6)19-15-27/h7-19,21-22,30,32-33,36H,20H2,1-6H3,(H,41,42,47)/b40-21+/t30-,32-,33-,36-/m1/s1 |
| InChIKey | BOIMOGFEAYUDAW-OEXFVIEGSA-N |
| XLogP | 4.84 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|