C30H34BrClN6O5Si — CID 177495234
[(2R,3S,4S,5R)-4-bromo-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] carbonochloridate (PubChem CID 177495234) has the molecular formula C30H34BrClN6O5Si and a molecular weight of 702.08 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4-bromo-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] carbonochloridate.
| Compound Name | [(2R,3S,4S,5R)-4-bromo-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] carbonochloridate |
|---|---|
| PubChem CID | 177495234 |
| Molecular Formula | C30H34BrClN6O5Si |
| Molecular Weight | 702.08 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | [(2R,3S,4S,5R)-4-bromo-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]oxolan-3-yl] carbonochloridate |
| SMILES | CN(C)/C=N/c1nc2c(ncn2[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](Br)[C@H]2OC(=O)Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C30H34BrClN6O5Si/c1-30(2,3)44(19-12-8-6-9-13-19,20-14-10-7-11-15-20)41-16-21-22(31)24(43-28(32)40)27(42-21)38-18-33-23-25(38)35-29(36-26(23)39)34-17-37(4)5/h6-15,17-18,21-22,24,27H,16H2,1-5H3,(H,35,36,39)/b34-17+/t21-,22+,24-,27-/m1/s1 |
| InChIKey | JCAUCQDAQCRZJQ-XKCBUWKPSA-N |
| XLogP | 4.32 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.08 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|