C29H36N6O4Si — CID 174037880
N'-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 174037880) has the molecular formula C29H36N6O4Si and a molecular weight of 560.73 g/mol. Its IUPAC name is N'-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 174037880 |
| Molecular Formula | C29H36N6O4Si |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N'-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nc2c(cnn2[C@H]2CC(O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C29H36N6O4Si/c1-29(2,3)40(20-12-8-6-9-13-20,21-14-10-7-11-15-21)38-18-24-23(36)16-25(39-24)35-26-22(17-31-35)27(37)33-28(32-26)30-19-34(4)5/h6-15,17,19,23-25,36H,16,18H2,1-5H3,(H,32,33,37)/t23?,24-,25-/m1/s1 |
| InChIKey | JGYJMUCJDGCXOJ-OPWSDZRHSA-N |
| XLogP | 2.57 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|