C16H24N6O4S2 — CID 174037990
N'-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 174037990) has the molecular formula C16H24N6O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N'-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 174037990 |
| Molecular Formula | C16H24N6O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N'-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CSS[C@@H](C)OC1C[C@H](n2ncc3c(=O)[nH]c(N=CN(C)C)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C16H24N6O4S2/c1-9(28-27-4)25-11-5-13(26-12(11)7-23)22-14-10(6-18-22)15(24)20-16(19-14)17-8-21(2)3/h6,8-9,11-13,23H,5,7H2,1-4H3,(H,19,20,24)/t9-,11?,12+,13+/m0/s1 |
| InChIKey | VICIJQKRBWTNGD-MGKYASQGSA-N |
| XLogP | 1.36 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|