C22H35N8O4P — CID 169020901
N'-[1-[(2R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 169020901) has the molecular formula C22H35N8O4P and a molecular weight of 508.56 g/mol. Its IUPAC name is N'-[1-[(2R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 169020901 |
| Molecular Formula | C22H35N8O4P |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N'-[1-[(2R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | [3H]OC[C@H]1O[C@@H](n2ncc3c(/N=C/N(C)C)ncnc32)C[C@H]1OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H35N8O4P/c1-15(2)30(16(3)4)35(32-9-8-23-5)34-18-10-20(33-19(18)12-31)29-22-17(11-27-29)21(24-13-25-22)26-14-28(6)7/h11,13-16,18-20,31H,8-10,12H2,1-4,6-7H3/b26-14+/t18-,19-,20-,35?/m1/s1/i31T |
| InChIKey | BNTLWHAFCNUZNO-RIMRWRNMSA-N |
| XLogP | 2.99 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|