C21H32N7O4PS — CID 59045419
9-[4-[dimethylamino(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]-N-methyl-8-pent-4-enylsulfanylpurin-6-amine (PubChem CID 59045419) has the molecular formula C21H32N7O4PS and a molecular weight of 511.58 g/mol. Its IUPAC name is 9-[4-[dimethylamino(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]-N-methyl-8-pent-4-enylsulfanylpurin-6-amine.
| Compound Name | 9-[4-[dimethylamino(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]-N-methyl-8-pent-4-enylsulfanylpurin-6-amine |
|---|---|
| PubChem CID | 59045419 |
| Molecular Formula | C21H32N7O4PS |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 9-[4-[dimethylamino(2-isocyanoethoxy)phosphanyl]oxy-5-(tritiooxymethyl)oxolan-2-yl]-N-methyl-8-pent-4-enylsulfanylpurin-6-amine |
| SMILES | [3H]OCC1OC(n2c(SCCCC=C)nc3c(NC)ncnc32)CC1OP(OCC[N+]#[C-])N(C)C |
| InChI | InChI=1S/C21H32N7O4PS/c1-6-7-8-11-34-21-26-18-19(23-3)24-14-25-20(18)28(21)17-12-15(16(13-29)31-17)32-33(27(4)5)30-10-9-22-2/h6,14-17,29H,1,7-13H2,3-5H3,(H,23,24,25)/i29T |
| InChIKey | FAPGSEKMROUECP-FZOYFJBJSA-N |
| XLogP | 3.32 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|