C41H50N7O5P — CID 171320706
3-[[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(methylamino)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]propanenitrile (PubChem CID 171320706) has the molecular formula C41H50N7O5P and a molecular weight of 751.87 g/mol. Its IUPAC name is 3-[[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(methylamino)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]propanenitrile.
| Compound Name | 3-[[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(methylamino)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]propanenitrile |
|---|---|
| PubChem CID | 171320706 |
| Molecular Formula | C41H50N7O5P |
| Molecular Weight | 751.87 g/mol |
| Exact Mass | 751.36 |
| IUPAC Name | 3-[[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(methylamino)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]propanenitrile |
| SMILES | CNc1ncnc2c1ncn2C1CC(OP(CCC#N)N(C(C)C)C(C)C)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C41H50N7O5P/c1-28(2)48(29(3)4)54(23-11-22-42)53-35-24-37(47-27-46-38-39(43-5)44-26-45-40(38)47)52-36(35)25-51-41(30-12-9-8-10-13-30,31-14-18-33(49-6)19-15-31)32-16-20-34(50-7)21-17-32/h8-10,12-21,26-29,35-37H,11,23-25H2,1-7H3,(H,43,44,45) |
| InChIKey | LSDFSGTYWIKLOI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.87 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|