C23H29N5O4Si — CID 15375546
N-[(1R,11R,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-7-yl]benzamide (PubChem CID 15375546) has the molecular formula C23H29N5O4Si and a molecular weight of 467.60 g/mol. Its IUPAC name is N-[(1R,11R,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-7-yl]benzamide.
| Compound Name | N-[(1R,11R,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-7-yl]benzamide |
|---|---|
| PubChem CID | 15375546 |
| Molecular Formula | C23H29N5O4Si |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[(1R,11R,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-7-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H]2O[C@@H]1[C@H](O)c1nc3c(NC(=O)c4ccccc4)ncnc3n12 |
| InChI | InChI=1S/C23H29N5O4Si/c1-23(2,3)33(4,5)32-14-11-15-28-20-16(26-21(28)17(29)18(14)31-15)19(24-12-25-20)27-22(30)13-9-7-6-8-10-13/h6-10,12,14-15,17-18,29H,11H2,1-5H3,(H,24,25,27,30)/t14-,15+,17-,18-/m0/s1 |
| InChIKey | DFDGDTYAHOKPQZ-MVJTYMMSSA-N |
| XLogP | 3.80 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|