C26H34BrN5O5Si — CID 15509541
N-[9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-bromopurin-6-yl]benzamide (PubChem CID 15509541) has the molecular formula C26H34BrN5O5Si and a molecular weight of 604.58 g/mol. Its IUPAC name is N-[9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-bromopurin-6-yl]benzamide.
| Compound Name | N-[9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-bromopurin-6-yl]benzamide |
|---|---|
| PubChem CID | 15509541 |
| Molecular Formula | C26H34BrN5O5Si |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | N-[9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-bromopurin-6-yl]benzamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]2n1c(Br)nc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C26H34BrN5O5Si/c1-25(2,3)38(6,7)34-13-16-18-19(37-26(4,5)36-18)23(35-16)32-21-17(30-24(32)27)20(28-14-29-21)31-22(33)15-11-9-8-10-12-15/h8-12,14,16,18-19,23H,13H2,1-7H3,(H,28,29,31,33)/t16-,18-,19-,23-/m1/s1 |
| InChIKey | FGTQQXCAWXMAOF-DYVMYPEFSA-N |
| XLogP | 5.28 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|