C27H36N7O4P — CID 58312284
N-[9-[4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 58312284) has the molecular formula C27H36N7O4P and a molecular weight of 553.60 g/mol. Its IUPAC name is N-[9-[4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 58312284 |
| Molecular Formula | C27H36N7O4P |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | N-[9-[4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | [C-]#[N+]CCOP(OC1CC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)OC1CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H36N7O4P/c1-7-21-22(38-39(36-14-13-28-6)34(18(2)3)19(4)5)15-23(37-21)33-17-31-24-25(29-16-30-26(24)33)32-27(35)20-11-9-8-10-12-20/h8-12,16-19,21-23H,7,13-15H2,1-5H3,(H,29,30,32,35) |
| InChIKey | OJOGXFWIBNHVCB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|