C45H53N8O4P — CID 170133424
N-[9-[5-[[3-aminopropoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 170133424) has the molecular formula C45H53N8O4P and a molecular weight of 800.94 g/mol. Its IUPAC name is N-[9-[5-[[3-aminopropoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[5-[[3-aminopropoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 170133424 |
| Molecular Formula | C45H53N8O4P |
| Molecular Weight | 800.94 g/mol |
| Exact Mass | 800.39 |
| IUPAC Name | N-[9-[5-[[3-aminopropoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)N(C(C)C)P(OCCCN)OCC1OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)CC1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H53N8O4P/c1-32(2)53(33(3)4)58(55-27-17-26-46)56-29-39-38(51-45(35-20-11-6-12-21-35,36-22-13-7-14-23-36)37-24-15-8-16-25-37)28-40(57-39)52-31-49-41-42(47-30-48-43(41)52)50-44(54)34-18-9-5-10-19-34/h5-16,18-25,30-33,38-40,51H,17,26-29,46H2,1-4H3,(H,47,48,50,54) |
| InChIKey | CSDNCQGSSQBIME-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.94 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|