C40H36N6O6 — CID 10556622
4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-(tritylamino)oxolan-2-yl]methoxy]-4-oxobutanoic acid (PubChem CID 10556622) has the molecular formula C40H36N6O6 and a molecular weight of 696.76 g/mol. Its IUPAC name is 4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-(tritylamino)oxolan-2-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-(tritylamino)oxolan-2-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10556622 |
| Molecular Formula | C40H36N6O6 |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | 4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-(tritylamino)oxolan-2-yl]methoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)C[C@@H]1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H36N6O6/c47-34(48)21-22-35(49)51-24-32-31(45-40(28-15-7-2-8-16-28,29-17-9-3-10-18-29)30-19-11-4-12-20-30)23-33(52-32)46-26-43-36-37(41-25-42-38(36)46)44-39(50)27-13-5-1-6-14-27/h1-20,25-26,31-33,45H,21-24H2,(H,47,48)(H,41,42,44,50)/t31-,32+,33+/m0/s1 |
| InChIKey | ZEKOBEQBFMLGJJ-WIHCDAFUSA-N |
| XLogP | 5.72 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|