C24H23N5O6S — CID 166430198
[(2R,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 166430198) has the molecular formula C24H23N5O6S and a molecular weight of 509.54 g/mol. Its IUPAC name is [(2R,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 166430198 |
| Molecular Formula | C24H23N5O6S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [(2R,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)CC2O)cc1 |
| InChI | InChI=1S/C24H23N5O6S/c1-15-7-9-17(10-8-15)36(32,33)34-12-19-18(30)11-20(35-19)29-14-27-21-22(25-13-26-23(21)29)28-24(31)16-5-3-2-4-6-16/h2-10,13-14,18-20,30H,11-12H2,1H3,(H,25,26,28,31)/t18?,19-,20-/m1/s1 |
| InChIKey | WKKHVMZOYIFZSA-FXJNCMGBSA-N |
| XLogP | 2.44 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|