C21H24N6O5S — CID 23250930
(2S)-2-amino-4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 23250930) has the molecular formula C21H24N6O5S and a molecular weight of 472.53 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 23250930 |
| Molecular Formula | C21H24N6O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,5R)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | N[C@@H](CCSC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)C[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C21H24N6O5S/c22-13(21(30)31)6-7-33-9-15-14(28)8-16(32-15)27-11-25-17-18(23-10-24-19(17)27)26-20(29)12-4-2-1-3-5-12/h1-5,10-11,13-16,28H,6-9,22H2,(H,30,31)(H,23,24,26,29)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | WXEORCYEUUOGDH-CAOSSQGBSA-N |
| XLogP | 1.26 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|