C14H20N6O4S — CID 54173585
(2S)-2-amino-4-[[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 54173585) has the molecular formula C14H20N6O4S and a molecular weight of 368.42 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 54173585 |
| Molecular Formula | C14H20N6O4S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CSCC[C@H](N)C(=O)O)O1 |
| InChI | InChI=1S/C14H20N6O4S/c15-7(14(22)23)1-2-25-4-9-8(21)3-10(24-9)20-6-19-11-12(16)17-5-18-13(11)20/h5-10,21H,1-4,15H2,(H,22,23)(H2,16,17,18)/t7-,8-,9+,10+/m0/s1 |
| InChIKey | OWRYWHNGEKTMGZ-AXTSPUMRSA-N |
| XLogP | -0.41 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|