C44H49N6O5P — CID 118705342
N-[1-[(2R,4S,5S)-5-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 118705342) has the molecular formula C44H49N6O5P and a molecular weight of 772.89 g/mol. Its IUPAC name is N-[1-[(2R,4S,5S)-5-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4S,5S)-5-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 118705342 |
| Molecular Formula | C44H49N6O5P |
| Molecular Weight | 772.89 g/mol |
| Exact Mass | 772.35 |
| IUPAC Name | N-[1-[(2R,4S,5S)-5-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-4-(tritylamino)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | [C-]#[N+]CCOP(OC[C@H]1O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)C[C@@H]1NC(c1ccccc1)(c1ccccc1)c1ccccc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C44H49N6O5P/c1-32(2)50(33(3)4)56(53-29-27-45-5)54-31-39-38(30-41(55-39)49-28-26-40(47-43(49)52)46-42(51)34-18-10-6-11-19-34)48-44(35-20-12-7-13-21-35,36-22-14-8-15-23-36)37-24-16-9-17-25-37/h6-26,28,32-33,38-39,41,48H,27,29-31H2,1-4H3,(H,46,47,51,52)/t38-,39+,41+,56?/m0/s1 |
| InChIKey | ASVMQOBVCKMCOW-LEYPHQFNSA-N |
| XLogP | 8.03 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.89 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|