C42H55N4O8P — CID 142452550
N-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 142452550) has the molecular formula C42H55N4O8P and a molecular weight of 774.90 g/mol. Its IUPAC name is N-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 142452550 |
| Molecular Formula | C42H55N4O8P |
| Molecular Weight | 774.90 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | N-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CCCCOP(OC1CC(n2ccc(NC(C)=O)nc2=O)OC1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C42H55N4O8P/c1-9-10-26-52-55(46(29(2)3)30(4)5)54-37-27-40(45-25-24-39(43-31(6)47)44-41(45)48)53-38(37)28-51-42(32-14-12-11-13-15-32,33-16-20-35(49-7)21-17-33)34-18-22-36(50-8)23-19-34/h11-25,29-30,37-38,40H,9-10,26-28H2,1-8H3,(H,43,44,47,48) |
| InChIKey | QJTKSGSAXBLMNW-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.90 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|