C43H56N3O8P — CID 160725803
1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-4-(2-oxopropyl)pyrimidin-2-one (PubChem CID 160725803) has the molecular formula C43H56N3O8P and a molecular weight of 773.91 g/mol. Its IUPAC name is 1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-4-(2-oxopropyl)pyrimidin-2-one.
| Compound Name | 1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-4-(2-oxopropyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 160725803 |
| Molecular Formula | C43H56N3O8P |
| Molecular Weight | 773.91 g/mol |
| Exact Mass | 773.38 |
| IUPAC Name | 1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-4-(2-oxopropyl)pyrimidin-2-one |
| SMILES | CCCCOP(OC1CC(n2ccc(CC(C)=O)nc2=O)OC1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C43H56N3O8P/c1-9-10-26-52-55(46(30(2)3)31(4)5)54-39-28-41(45-25-24-36(27-32(6)47)44-42(45)48)53-40(39)29-51-43(33-14-12-11-13-15-33,34-16-20-37(49-7)21-17-34)35-18-22-38(50-8)23-19-35/h11-25,30-31,39-41H,9-10,26-29H2,1-8H3 |
| InChIKey | RTRQTSRLZRSZLV-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 110.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.91 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|