C26H34N7O4P — CID 130245060
N-[9-[(2R,5S)-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 130245060) has the molecular formula C26H34N7O4P and a molecular weight of 539.58 g/mol. Its IUPAC name is N-[9-[(2R,5S)-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,5S)-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 130245060 |
| Molecular Formula | C26H34N7O4P |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[9-[(2R,5S)-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC[C@@H]1CC[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C26H34N7O4P/c1-18(2)33(19(3)4)38(35-14-8-13-27)36-15-21-11-12-22(37-21)32-17-30-23-24(28-16-29-25(23)32)31-26(34)20-9-6-5-7-10-20/h5-7,9-10,16-19,21-22H,8,11-12,14-15H2,1-4H3,(H,28,29,31,34)/t21-,22+,38?/m0/s1 |
| InChIKey | UQWIKIQUUPAEDQ-ZHJGYOKLSA-N |
| XLogP | 5.05 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|