C27H36N7O5P — CID 160788681
N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 160788681) has the molecular formula C27H36N7O5P and a molecular weight of 570.61 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 160788681 |
| Molecular Formula | C27H36N7O5P |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | [2H]C[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](OC)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H36N7O5P/c1-17(2)34(18(3)4)40(37-14-10-13-28)39-22-19(5)38-27(23(22)36-6)33-16-31-21-24(29-15-30-25(21)33)32-26(35)20-11-8-7-9-12-20/h7-9,11-12,15-19,22-23,27H,10,14H2,1-6H3,(H,29,30,32,35)/t19-,22-,23-,27-,40?/m1/s1/i5D |
| InChIKey | FSTQKMVJFJFMHI-CLZHXPNZSA-N |
| XLogP | 4.67 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|