C28H36N7O5P — CID 167623685
N-[9-[(1S,3S,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide (PubChem CID 167623685) has the molecular formula C28H36N7O5P and a molecular weight of 581.61 g/mol. Its IUPAC name is N-[9-[(1S,3S,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1S,3S,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 167623685 |
| Molecular Formula | C28H36N7O5P |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | N-[9-[(1S,3S,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide |
| SMILES | CC[C@@]12CO[C@@H]([C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O1)[C@@H]2OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C28H36N7O5P/c1-6-28-15-37-22(23(28)40-41(38-14-10-13-29)35(18(2)3)19(4)5)27(39-28)34-17-32-21-24(30-16-31-25(21)34)33-26(36)20-11-8-7-9-12-20/h7-9,11-12,16-19,22-23,27H,6,10,14-15H2,1-5H3,(H,30,31,33,36)/t22-,23+,27+,28+,41?/m1/s1 |
| InChIKey | PMRTVHJCXJSELB-OYUIFMQUSA-N |
| XLogP | 4.82 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|