C28H39N8O7PS — CID 156513881
N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(methanesulfonamidomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 156513881) has the molecular formula C28H39N8O7PS and a molecular weight of 662.71 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(methanesulfonamidomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(methanesulfonamidomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 156513881 |
| Molecular Formula | C28H39N8O7PS |
| Molecular Weight | 662.71 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(methanesulfonamidomethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CO[C@@H]1[C@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](CNS(C)(=O)=O)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C28H39N8O7PS/c1-18(2)36(19(3)4)44(41-14-10-13-29)43-23-21(15-33-45(6,38)39)42-28(24(23)40-5)35-17-32-22-25(30-16-31-26(22)35)34-27(37)20-11-8-7-9-12-20/h7-9,11-12,16-19,21,23-24,28,33H,10,14-15H2,1-6H3,(H,30,31,34,37)/t21-,23-,24-,28-,44?/m1/s1 |
| InChIKey | KILSRRDSMMIPET-MUXRPOTISA-N |
| XLogP | 3.20 |
| TPSA | 182.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|