C29H39F2N8O6P — CID 155054005
N-[9-[(2R,3R,4R,5S)-4-amino-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-3-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 155054005) has the molecular formula C29H39F2N8O6P and a molecular weight of 664.65 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5S)-4-amino-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-3-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5S)-4-amino-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-3-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 155054005 |
| Molecular Formula | C29H39F2N8O6P |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | N-[9-[(2R,3R,4R,5S)-4-amino-5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-3-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COCC(F)(F)O[C@@H]1[C@H](N)[C@@H](COP(OCCC#N)N(C(C)C)C(C)C)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C29H39F2N8O6P/c1-18(2)39(19(3)4)46(42-13-9-12-32)43-14-21-22(33)24(45-29(30,31)15-41-5)28(44-21)38-17-36-23-25(34-16-35-26(23)38)37-27(40)20-10-7-6-8-11-20/h6-8,10-11,16-19,21-22,24,28H,9,13-15,33H2,1-5H3,(H,34,35,37,40)/t21-,22-,24-,28-,46?/m1/s1 |
| InChIKey | LKPQDBWJLVOCPH-DMEOWBCQSA-N |
| XLogP | 4.22 |
| TPSA | 171.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|