C28H38N7O5P — CID 158943494
N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(1,1-dideuterioethyl)-3-(trideuteriomethoxy)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 158943494) has the molecular formula C28H38N7O5P and a molecular weight of 588.66 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(1,1-dideuterioethyl)-3-(trideuteriomethoxy)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(1,1-dideuterioethyl)-3-(trideuteriomethoxy)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 158943494 |
| Molecular Formula | C28H38N7O5P |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(1,1-dideuterioethyl)-3-(trideuteriomethoxy)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | [2H]C([2H])([2H])O[C@@H]1[C@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](C([2H])([2H])C)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C28H38N7O5P/c1-7-21-23(40-41(38-15-11-14-29)35(18(2)3)19(4)5)24(37-6)28(39-21)34-17-32-22-25(30-16-31-26(22)34)33-27(36)20-12-9-8-10-13-20/h8-10,12-13,16-19,21,23-24,28H,7,11,15H2,1-6H3,(H,30,31,33,36)/t21-,23-,24-,28-,41?/m1/s1/i6D3,7D2 |
| InChIKey | JKNSMWOUKDYBFL-OTOWZBAGSA-N |
| XLogP | 5.06 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|