C28H38N7O6P — CID 159119075
N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-(deuteriomethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide;tritiooxymethane (PubChem CID 159119075) has the molecular formula C28H38N7O6P and a molecular weight of 602.64 g/mol. Its IUPAC name is N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-(deuteriomethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide;tritiooxymethane.
| Compound Name | N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-(deuteriomethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide;tritiooxymethane |
|---|---|
| PubChem CID | 159119075 |
| Molecular Formula | C28H38N7O6P |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-(deuteriomethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide;tritiooxymethane |
| SMILES | [2H]C[C@@]12CO[C@@H]([C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O1)[C@@H]2OP(OCCC#N)N(C(C)C)C(C)C.[3H]OC |
| InChI | InChI=1S/C27H34N7O5P.CH4O/c1-17(2)34(18(3)4)40(37-13-9-12-28)39-22-21-26(38-27(22,5)14-36-21)33-16-31-20-23(29-15-30-24(20)33)32-25(35)19-10-7-6-8-11-19;1-2/h6-8,10-11,15-18,21-22,26H,9,13-14H2,1-5H3,(H,29,30,32,35);2H,1H3/t21-,22+,26-,27+,40?;/m1./s1/i5D;2T |
| InChIKey | KFLNKUXHQDVYHN-SFQUYSETSA-N |
| XLogP | 4.03 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|