C21H32N7O3P — CID 144955104
3-[[di(propan-2-yl)amino]-[[5-[6-[(Z)-ethylideneamino]purin-9-yl]oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile (PubChem CID 144955104) has the molecular formula C21H32N7O3P and a molecular weight of 461.51 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[[5-[6-[(Z)-ethylideneamino]purin-9-yl]oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[[5-[6-[(Z)-ethylideneamino]purin-9-yl]oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 144955104 |
| Molecular Formula | C21H32N7O3P |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[[5-[6-[(Z)-ethylideneamino]purin-9-yl]oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile |
| SMILES | C/C=N\c1ncnc2c1ncn2C1CCC(COP(OCCC#N)N(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C21H32N7O3P/c1-6-23-20-19-21(25-13-24-20)27(14-26-19)18-9-8-17(31-18)12-30-32(29-11-7-10-22)28(15(2)3)16(4)5/h6,13-18H,7-9,11-12H2,1-5H3/b23-6- |
| InChIKey | PBCZLKBPEKKYQQ-OUBWWKSTSA-N |
| XLogP | 4.52 |
| TPSA | 110.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|