C13H13N5O4 — CID 155062707
[(2S,5R)-5-(6-isocyanatopurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 155062707) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is [(2S,5R)-5-(6-isocyanatopurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,5R)-5-(6-isocyanatopurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155062707 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | [(2S,5R)-5-(6-isocyanatopurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC[C@H](n2cnc3c(N=C=O)ncnc32)O1 |
| InChI | InChI=1S/C13H13N5O4/c1-8(20)21-4-9-2-3-10(22-9)18-6-16-11-12(17-7-19)14-5-15-13(11)18/h5-6,9-10H,2-4H2,1H3/t9-,10+/m0/s1 |
| InChIKey | ZVYOVLBOZLXTKH-VHSXEESVSA-N |
| XLogP | 1.03 |
| TPSA | 108.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|