C13H19N4O6P — CID 155703606
[(2S,5R)-5-[6-(2-methoxyethyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 155703606) has the molecular formula C13H19N4O6P and a molecular weight of 358.29 g/mol. Its IUPAC name is [(2S,5R)-5-[6-(2-methoxyethyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,5R)-5-[6-(2-methoxyethyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155703606 |
| Molecular Formula | C13H19N4O6P |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [(2S,5R)-5-[6-(2-methoxyethyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COCCc1ncnc2c1ncn2[C@H]1CC[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C13H19N4O6P/c1-21-5-4-10-12-13(15-7-14-10)17(8-16-12)11-3-2-9(23-11)6-22-24(18,19)20/h7-9,11H,2-6H2,1H3,(H2,18,19,20)/t9-,11+/m0/s1 |
| InChIKey | USQXDMQWOCOAMG-GXSJLCMTSA-N |
| XLogP | 0.80 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|