C20H26N10O12P2 — CID 175626169
[(2R,3S,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 175626169) has the molecular formula C20H26N10O12P2 and a molecular weight of 660.43 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 175626169 |
| Molecular Formula | C20H26N10O12P2 |
| Molecular Weight | 660.43 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H](COP(=O)(O)O[C@H]2C(O)[C@H](n3c(=O)[nH]c4c(N)ncnc43)O[C@@H]2COP(=O)(O)O)O1 |
| InChI | InChI=1S/C20H26N10O12P2/c21-15-11-17(25-5-23-15)29(7-27-11)10-2-1-8(40-10)3-39-44(36,37)42-14-9(4-38-43(33,34)35)41-19(13(14)31)30-18-12(28-20(30)32)16(22)24-6-26-18/h5-10,13-14,19,31H,1-4H2,(H,28,32)(H,36,37)(H2,21,23,25)(H2,22,24,26)(H2,33,34,35)/t8-,9+,10+,13?,14+,19+/m0/s1 |
| InChIKey | CCTFKRFLTSOSHL-IDBPLNGVSA-N |
| XLogP | -1.33 |
| TPSA | 320.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.43 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|