C12H19N5O10P2 — CID 102511265
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] ethyl hydrogen phosphate (PubChem CID 102511265) has the molecular formula C12H19N5O10P2 and a molecular weight of 455.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] ethyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 102511265 |
| Molecular Formula | C12H19N5O10P2 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)O[C@H]1[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C12H19N5O10P2/c1-2-24-29(22,23)27-9-6(3-25-28(19,20)21)26-12(8(9)18)17-5-16-7-10(13)14-4-15-11(7)17/h4-6,8-9,12,18H,2-3H2,1H3,(H,22,23)(H2,13,14,15)(H2,19,20,21)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | ZLZDRRGFEXFMMK-WOUKDFQISA-N |
| XLogP | -0.70 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|