C14H22N5O6P — CID 176592701
[5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 176592701) has the molecular formula C14H22N5O6P and a molecular weight of 387.33 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 176592701 |
| Molecular Formula | C14H22N5O6P |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)(C)C1C(COP(=O)(O)O)OC(n2cnc3c(N)ncnc32)C1O |
| InChI | InChI=1S/C14H22N5O6P/c1-14(2,3)8-7(4-24-26(21,22)23)25-13(10(8)20)19-6-18-9-11(15)16-5-17-12(9)19/h5-8,10,13,20H,4H2,1-3H3,(H2,15,16,17)(H2,21,22,23) |
| InChIKey | QJLQVLJZMGXEFO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|