C17H28N5O6P — CID 176592697
[5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate (PubChem CID 176592697) has the molecular formula C17H28N5O6P and a molecular weight of 429.41 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate.
| Compound Name | [5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 176592697 |
| Molecular Formula | C17H28N5O6P |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3-tert-butyl-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1C(C)(C)C |
| InChI | InChI=1S/C17H28N5O6P/c1-9(2)28-29(24,25)26-6-10-11(17(3,4)5)13(23)16(27-10)22-8-21-12-14(18)19-7-20-15(12)22/h7-11,13,16,23H,6H2,1-5H3,(H,24,25)(H2,18,19,20) |
| InChIKey | QAGKJHWJVIULAD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|