C14H23N6O8P — CID 54403854
[(2R,3R)-2-amino-3-hydroxybutyl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 54403854) has the molecular formula C14H23N6O8P and a molecular weight of 434.35 g/mol. Its IUPAC name is [(2R,3R)-2-amino-3-hydroxybutyl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R)-2-amino-3-hydroxybutyl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 54403854 |
| Molecular Formula | C14H23N6O8P |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(2R,3R)-2-amino-3-hydroxybutyl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | C[C@@H](O)[C@H](N)COP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H23N6O8P/c1-6(21)7(15)2-26-29(24,25)27-3-8-10(22)11(23)14(28-8)20-5-19-9-12(16)17-4-18-13(9)20/h4-8,10-11,14,21-23H,2-3,15H2,1H3,(H,24,25)(H2,16,17,18)/t6-,7-,8-,10-,11-,14-/m1/s1 |
| InChIKey | VPHDLKUTUSQRCE-SMKPNTNISA-N |
| XLogP | -2.13 |
| TPSA | 221.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|