C18H29N5O14P2 — CID 10651235
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-propan-2-yloxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 10651235) has the molecular formula C18H29N5O14P2 and a molecular weight of 601.40 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-propan-2-yloxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-propan-2-yloxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 10651235 |
| Molecular Formula | C18H29N5O14P2 |
| Molecular Weight | 601.40 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-propan-2-yloxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CC(C)O[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H29N5O14P2/c1-7(2)34-18-14(27)12(25)9(36-18)4-33-39(30,31)37-38(28,29)32-3-8-11(24)13(26)17(35-8)23-6-22-10-15(19)20-5-21-16(10)23/h5-9,11-14,17-18,24-27H,3-4H2,1-2H3,(H,28,29)(H,30,31)(H2,19,20,21)/t8-,9-,11-,12-,13-,14-,17-,18-/m1/s1 |
| InChIKey | MNZKZQWAIGTMPZ-ZZJFPLALSA-N |
| XLogP | -1.85 |
| TPSA | 280.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.40 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|