C18H22N5O5PS — CID 155077532
[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-[(4-methoxyphenyl)methylsulfanyl]phosphinic acid (PubChem CID 155077532) has the molecular formula C18H22N5O5PS and a molecular weight of 451.45 g/mol. Its IUPAC name is [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-[(4-methoxyphenyl)methylsulfanyl]phosphinic acid.
| Compound Name | [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-[(4-methoxyphenyl)methylsulfanyl]phosphinic acid |
|---|---|
| PubChem CID | 155077532 |
| Molecular Formula | C18H22N5O5PS |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-[(4-methoxyphenyl)methylsulfanyl]phosphinic acid |
| SMILES | COc1ccc(CSP(=O)(O)OC[C@@H]2CC[C@H](n3cnc4c(N)ncnc43)O2)cc1 |
| InChI | InChI=1S/C18H22N5O5PS/c1-26-13-4-2-12(3-5-13)9-30-29(24,25)27-8-14-6-7-15(28-14)23-11-22-16-17(19)20-10-21-18(16)23/h2-5,10-11,14-15H,6-9H2,1H3,(H,24,25)(H2,19,20,21)/t14-,15+/m0/s1 |
| InChIKey | AOPCKYILDSAKPA-LSDHHAIUSA-N |
| XLogP | 3.15 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|